C27H24N2O6 — CID 18449813
tert-butyl 4-(2-methoxyphenoxy)-2-methyl-1,3-dioxopyrrolo[3,4-c]carbazole-6-carboxylate (PubChem CID 18449813) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is tert-butyl 4-(2-methoxyphenoxy)-2-methyl-1,3-dioxopyrrolo[3,4-c]carbazole-6-carboxylate.
| Compound Name | tert-butyl 4-(2-methoxyphenoxy)-2-methyl-1,3-dioxopyrrolo[3,4-c]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 18449813 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | tert-butyl 4-(2-methoxyphenoxy)-2-methyl-1,3-dioxopyrrolo[3,4-c]carbazole-6-carboxylate |
| SMILES | COc1ccccc1Oc1cc2c(c3c1C(=O)N(C)C3=O)c1ccccc1n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H24N2O6/c1-27(2,3)35-26(32)29-16-11-7-6-10-15(16)21-17(29)14-20(22-23(21)25(31)28(4)24(22)30)34-19-13-9-8-12-18(19)33-5/h6-14H,1-5H3 |
| InChIKey | ROGTXPUFHMZDNG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|