C14H15BrN2O3 — CID 175318804
tert-butyl 2-bromo-3-carbamoylindole-1-carboxylate (PubChem CID 175318804) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is tert-butyl 2-bromo-3-carbamoylindole-1-carboxylate.
| Compound Name | tert-butyl 2-bromo-3-carbamoylindole-1-carboxylate |
|---|---|
| PubChem CID | 175318804 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | tert-butyl 2-bromo-3-carbamoylindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(Br)c(C(N)=O)c2ccccc21 |
| InChI | InChI=1S/C14H15BrN2O3/c1-14(2,3)20-13(19)17-9-7-5-4-6-8(9)10(11(17)15)12(16)18/h4-7H,1-3H3,(H2,16,18) |
| InChIKey | DVUDDEUOFLQBGL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |