C16H19NO5 — CID 133055982
1-O-tert-butyl 2-O-ethyl 3-hydroxyindole-1,2-dicarboxylate (PubChem CID 133055982) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl 3-hydroxyindole-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl 3-hydroxyindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 133055982 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl 3-hydroxyindole-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1c(O)c2ccccc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H19NO5/c1-5-21-14(19)12-13(18)10-8-6-7-9-11(10)17(12)15(20)22-16(2,3)4/h6-9,18H,5H2,1-4H3 |
| InChIKey | GUZGWPCHOJIQIO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |