C24H23NO4 — CID 122233617
7-O-tert-butyl 5-O-ethyl benzo[c]carbazole-5,7-dicarboxylate (PubChem CID 122233617) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 7-O-tert-butyl 5-O-ethyl benzo[c]carbazole-5,7-dicarboxylate.
| Compound Name | 7-O-tert-butyl 5-O-ethyl benzo[c]carbazole-5,7-dicarboxylate |
|---|---|
| PubChem CID | 122233617 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 7-O-tert-butyl 5-O-ethyl benzo[c]carbazole-5,7-dicarboxylate |
| SMILES | CCOC(=O)c1cc2c(c3ccccc13)c1ccccc1n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H23NO4/c1-5-28-22(26)18-14-20-21(16-11-7-6-10-15(16)18)17-12-8-9-13-19(17)25(20)23(27)29-24(2,3)4/h6-14H,5H2,1-4H3 |
| InChIKey | CQKVHGRKFQUGCI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |