C19H19NO4 — CID 132516778
9-O-tert-butyl 4-O-methyl carbazole-4,9-dicarboxylate (PubChem CID 132516778) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 9-O-tert-butyl 4-O-methyl carbazole-4,9-dicarboxylate.
| Compound Name | 9-O-tert-butyl 4-O-methyl carbazole-4,9-dicarboxylate |
|---|---|
| PubChem CID | 132516778 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 9-O-tert-butyl 4-O-methyl carbazole-4,9-dicarboxylate |
| SMILES | COC(=O)c1cccc2c1c1ccccc1n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H19NO4/c1-19(2,3)24-18(22)20-14-10-6-5-8-12(14)16-13(17(21)23-4)9-7-11-15(16)20/h5-11H,1-4H3 |
| InChIKey | DKAPEAVWBCYSPQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |