C23H27N3O3 — CID 140960025
tert-butyl 4-[4-(2-oxoethyl)piperazin-1-yl]carbazole-9-carboxylate (PubChem CID 140960025) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is tert-butyl 4-[4-(2-oxoethyl)piperazin-1-yl]carbazole-9-carboxylate.
| Compound Name | tert-butyl 4-[4-(2-oxoethyl)piperazin-1-yl]carbazole-9-carboxylate |
|---|---|
| PubChem CID | 140960025 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | tert-butyl 4-[4-(2-oxoethyl)piperazin-1-yl]carbazole-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2ccccc2c2c(N3CCN(CC=O)CC3)cccc21 |
| InChI | InChI=1S/C23H27N3O3/c1-23(2,3)29-22(28)26-18-8-5-4-7-17(18)21-19(9-6-10-20(21)26)25-13-11-24(12-14-25)15-16-27/h4-10,16H,11-15H2,1-3H3 |
| InChIKey | SAMAUDWOGCNCFJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|