C30H32N2O8 — CID 134947943
tert-butyl 2-hydroxy-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2-prop-2-enoxycarbonyloxyindol-3-yl]indole-1-carboxylate (PubChem CID 134947943) has the molecular formula C30H32N2O8 and a molecular weight of 548.59 g/mol. Its IUPAC name is tert-butyl 2-hydroxy-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2-prop-2-enoxycarbonyloxyindol-3-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 2-hydroxy-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2-prop-2-enoxycarbonyloxyindol-3-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 134947943 |
| Molecular Formula | C30H32N2O8 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | tert-butyl 2-hydroxy-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2-prop-2-enoxycarbonyloxyindol-3-yl]indole-1-carboxylate |
| SMILES | C=CCOC(=O)Oc1c(-c2c(O)n(C(=O)OC(C)(C)C)c3ccccc23)c2ccccc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H32N2O8/c1-8-17-37-28(36)38-25-23(19-14-10-12-16-21(19)32(25)27(35)40-30(5,6)7)22-18-13-9-11-15-20(18)31(24(22)33)26(34)39-29(2,3)4/h8-16,33H,1,17H2,2-7H3 |
| InChIKey | NFTVXNCZJLVNRT-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|