C25H36N2O5 — CID 136961297
tert-butyl 3-[2-(decanoylamino)acetyl]-2-hydroxyindole-1-carboxylate (PubChem CID 136961297) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is tert-butyl 3-[2-(decanoylamino)acetyl]-2-hydroxyindole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(decanoylamino)acetyl]-2-hydroxyindole-1-carboxylate |
|---|---|
| PubChem CID | 136961297 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | tert-butyl 3-[2-(decanoylamino)acetyl]-2-hydroxyindole-1-carboxylate |
| SMILES | CCCCCCCCCC(=O)NCC(=O)c1c(O)n(C(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C25H36N2O5/c1-5-6-7-8-9-10-11-16-21(29)26-17-20(28)22-18-14-12-13-15-19(18)27(23(22)30)24(31)32-25(2,3)4/h12-15,30H,5-11,16-17H2,1-4H3,(H,26,29) |
| InChIKey | GAPTVJYRBWGTOA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|