C22H28N2O2 — CID 135059896
tert-butyl 3-hexylpyrido[3,4-b]indole-9-carboxylate (PubChem CID 135059896) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is tert-butyl 3-hexylpyrido[3,4-b]indole-9-carboxylate.
| Compound Name | tert-butyl 3-hexylpyrido[3,4-b]indole-9-carboxylate |
|---|---|
| PubChem CID | 135059896 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl 3-hexylpyrido[3,4-b]indole-9-carboxylate |
| SMILES | CCCCCCc1cc2c3ccccc3n(C(=O)OC(C)(C)C)c2cn1 |
| InChI | InChI=1S/C22H28N2O2/c1-5-6-7-8-11-16-14-18-17-12-9-10-13-19(17)24(20(18)15-23-16)21(25)26-22(2,3)4/h9-10,12-15H,5-8,11H2,1-4H3 |
| InChIKey | BCSGUDMKJWPBBI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|