C19H22N4O5 — CID 141337720
tert-butyl 3-[2-(hydroxyamino)oxyethylcarbamoyl]pyrido[3,4-b]indole-9-carboxylate (PubChem CID 141337720) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is tert-butyl 3-[2-(hydroxyamino)oxyethylcarbamoyl]pyrido[3,4-b]indole-9-carboxylate.
| Compound Name | tert-butyl 3-[2-(hydroxyamino)oxyethylcarbamoyl]pyrido[3,4-b]indole-9-carboxylate |
|---|---|
| PubChem CID | 141337720 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | tert-butyl 3-[2-(hydroxyamino)oxyethylcarbamoyl]pyrido[3,4-b]indole-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2ccccc2c2cc(C(=O)NCCONO)ncc21 |
| InChI | InChI=1S/C19H22N4O5/c1-19(2,3)28-18(25)23-15-7-5-4-6-12(15)13-10-14(21-11-16(13)23)17(24)20-8-9-27-22-26/h4-7,10-11,22,26H,8-9H2,1-3H3,(H,20,24) |
| InChIKey | XTPSMTPVRNIQFD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|