C25H23N5O5 — CID 78427442
tert-butyl 3-[[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]carbamoyl]pyrido[3,4-b]indole-9-carboxylate (PubChem CID 78427442) has the molecular formula C25H23N5O5 and a molecular weight of 473.49 g/mol. Its IUPAC name is tert-butyl 3-[[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]carbamoyl]pyrido[3,4-b]indole-9-carboxylate.
| Compound Name | tert-butyl 3-[[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]carbamoyl]pyrido[3,4-b]indole-9-carboxylate |
|---|---|
| PubChem CID | 78427442 |
| Molecular Formula | C25H23N5O5 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | tert-butyl 3-[[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]carbamoyl]pyrido[3,4-b]indole-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2ccccc2c2cc(C(=O)N/N=C/c3ccc(C(=O)NO)cc3)ncc21 |
| InChI | InChI=1S/C25H23N5O5/c1-25(2,3)35-24(33)30-20-7-5-4-6-17(20)18-12-19(26-14-21(18)30)23(32)28-27-13-15-8-10-16(11-9-15)22(31)29-34/h4-14,34H,1-3H3,(H,28,32)(H,29,31)/b27-13+ |
| InChIKey | VBJSDDODPVLGDS-UVHMKAGCSA-N |
| XLogP | 3.86 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|