C33H32N6O5 — CID 78427312
tert-butyl 1-[4-(dimethylamino)phenyl]-3-[[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]carbamoyl]pyrido[3,4-b]indole-9-carboxylate (PubChem CID 78427312) has the molecular formula C33H32N6O5 and a molecular weight of 592.66 g/mol. Its IUPAC name is tert-butyl 1-[4-(dimethylamino)phenyl]-3-[[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]carbamoyl]pyrido[3,4-b]indole-9-carboxylate.
| Compound Name | tert-butyl 1-[4-(dimethylamino)phenyl]-3-[[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]carbamoyl]pyrido[3,4-b]indole-9-carboxylate |
|---|---|
| PubChem CID | 78427312 |
| Molecular Formula | C33H32N6O5 |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | tert-butyl 1-[4-(dimethylamino)phenyl]-3-[[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]carbamoyl]pyrido[3,4-b]indole-9-carboxylate |
| SMILES | CN(C)c1ccc(-c2nc(C(=O)N/N=C/c3ccc(C(=O)NO)cc3)cc3c4ccccc4n(C(=O)OC(C)(C)C)c23)cc1 |
| InChI | InChI=1S/C33H32N6O5/c1-33(2,3)44-32(42)39-27-9-7-6-8-24(27)25-18-26(35-28(29(25)39)21-14-16-23(17-15-21)38(4)5)31(41)36-34-19-20-10-12-22(13-11-20)30(40)37-43/h6-19,43H,1-5H3,(H,36,41)(H,37,40)/b34-19+ |
| InChIKey | DNVNIXYMYVPSDR-ALQBTCKLSA-N |
| XLogP | 5.59 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|