C27H19N5O5 — CID 78426902
1-(1,3-benzodioxol-5-yl)-N-[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 78426902) has the molecular formula C27H19N5O5 and a molecular weight of 493.48 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 78426902 |
| Molecular Formula | C27H19N5O5 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | O=C(NO)c1ccc(/C=N/NC(=O)c2cc3c([nH]c4ccccc43)c(-c3ccc4c(c3)OCO4)n2)cc1 |
| InChI | InChI=1S/C27H19N5O5/c33-26(32-35)16-7-5-15(6-8-16)13-28-31-27(34)21-12-19-18-3-1-2-4-20(18)29-25(19)24(30-21)17-9-10-22-23(11-17)37-14-36-22/h1-13,29,35H,14H2,(H,31,34)(H,32,33)/b28-13+ |
| InChIKey | ZROJKEHWNFAHMG-XODNFHPESA-N |
| XLogP | 3.99 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|