C18H25N7O — CID 3659408
2,6-bis(dimethylamino)-N-[[4-(dimethylamino)phenyl]methylideneamino]pyrimidine-4-carboxamide (PubChem CID 3659408) has the molecular formula C18H25N7O and a molecular weight of 355.45 g/mol. Its IUPAC name is 2,6-bis(dimethylamino)-N-[[4-(dimethylamino)phenyl]methylideneamino]pyrimidine-4-carboxamide.
| Compound Name | 2,6-bis(dimethylamino)-N-[[4-(dimethylamino)phenyl]methylideneamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 3659408 |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2,6-bis(dimethylamino)-N-[[4-(dimethylamino)phenyl]methylideneamino]pyrimidine-4-carboxamide |
| SMILES | CN(C)c1ccc(C=NNC(=O)c2cc(N(C)C)nc(N(C)C)n2)cc1 |
| InChI | InChI=1S/C18H25N7O/c1-23(2)14-9-7-13(8-10-14)12-19-22-17(26)15-11-16(24(3)4)21-18(20-15)25(5)6/h7-12H,1-6H3,(H,22,26) |
| InChIKey | GJPBIHHDUGCOGT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|