C16H15I2N3O2 — CID 13443214
N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-hydroxy-3,5-di(125I)iodo(125I2)benzamide (PubChem CID 13443214) has the molecular formula C16H15I2N3O2 and a molecular weight of 531.12 g/mol. Its IUPAC name is N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-hydroxy-3,5-di(125I)iodo(125I2)benzamide.
| Compound Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-hydroxy-3,5-di(125I)iodo(125I2)benzamide |
|---|---|
| PubChem CID | 13443214 |
| Molecular Formula | C16H15I2N3O2 |
| Molecular Weight | 531.12 g/mol |
| Exact Mass | 530.93 |
| IUPAC Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-hydroxy-3,5-di(125I)iodo(125I2)benzamide |
| SMILES | CN(C)c1ccc(/C=N/NC(=O)c2cc([125I])c(O)c([125I])c2)cc1 |
| InChI | InChI=1S/C16H15I2N3O2/c1-21(2)12-5-3-10(4-6-12)9-19-20-16(23)11-7-13(17)15(22)14(18)8-11/h3-9,22H,1-2H3,(H,20,23)/b19-9+/i17-2,18-2 |
| InChIKey | MICWMZDHQHOXQE-GWJFTSPFSA-N |
| XLogP | 3.43 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.12 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|