C15H19N7O2 — CID 136715580
4,6-bis(dimethylamino)-N-[(Z)-(4-hydroxyphenyl)methylideneamino]-1,3,5-triazine-2-carboxamide (PubChem CID 136715580) has the molecular formula C15H19N7O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 4,6-bis(dimethylamino)-N-[(Z)-(4-hydroxyphenyl)methylideneamino]-1,3,5-triazine-2-carboxamide.
| Compound Name | 4,6-bis(dimethylamino)-N-[(Z)-(4-hydroxyphenyl)methylideneamino]-1,3,5-triazine-2-carboxamide |
|---|---|
| PubChem CID | 136715580 |
| Molecular Formula | C15H19N7O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4,6-bis(dimethylamino)-N-[(Z)-(4-hydroxyphenyl)methylideneamino]-1,3,5-triazine-2-carboxamide |
| SMILES | CN(C)c1nc(C(=O)N/N=C\c2ccc(O)cc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C15H19N7O2/c1-21(2)14-17-12(18-15(19-14)22(3)4)13(24)20-16-9-10-5-7-11(23)8-6-10/h5-9,23H,1-4H3,(H,20,24)/b16-9- |
| InChIKey | VZORTCMXIRKTGJ-SXGWCWSVSA-N |
| XLogP | 0.47 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|