C13H14BrN5O — CID 835569
4-bromo-N-[[4-(dimethylamino)phenyl]methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 835569) has the molecular formula C13H14BrN5O and a molecular weight of 336.19 g/mol. Its IUPAC name is 4-bromo-N-[[4-(dimethylamino)phenyl]methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-[[4-(dimethylamino)phenyl]methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 835569 |
| Molecular Formula | C13H14BrN5O |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-bromo-N-[[4-(dimethylamino)phenyl]methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | CN(C)c1ccc(C=NNC(=O)c2[nH]ncc2Br)cc1 |
| InChI | InChI=1S/C13H14BrN5O/c1-19(2)10-5-3-9(4-6-10)7-15-18-13(20)12-11(14)8-16-17-12/h3-8H,1-2H3,(H,16,17)(H,18,20) |
| InChIKey | ZLWGIFBVWLHCMT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|