C18H19N5O — CID 14983896
3-amino-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1H-indole-2-carboxamide (PubChem CID 14983896) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-amino-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1H-indole-2-carboxamide.
| Compound Name | 3-amino-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 14983896 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 3-amino-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1H-indole-2-carboxamide |
| SMILES | CN(C)c1ccc(/C=N/NC(=O)c2[nH]c3ccccc3c2N)cc1 |
| InChI | InChI=1S/C18H19N5O/c1-23(2)13-9-7-12(8-10-13)11-20-22-18(24)17-16(19)14-5-3-4-6-15(14)21-17/h3-11,21H,19H2,1-2H3,(H,22,24)/b20-11+ |
| InChIKey | FPENWBGHSHVYLI-RGVLZGJSSA-N |
| XLogP | 2.58 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|