C17H14BrN3O — CID 70129332
N-[(4-bromophenyl)methylideneamino]-3-methyl-1H-indole-2-carboxamide (PubChem CID 70129332) has the molecular formula C17H14BrN3O and a molecular weight of 356.22 g/mol. Its IUPAC name is N-[(4-bromophenyl)methylideneamino]-3-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[(4-bromophenyl)methylideneamino]-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70129332 |
| Molecular Formula | C17H14BrN3O |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | N-[(4-bromophenyl)methylideneamino]-3-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NN=Cc2ccc(Br)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C17H14BrN3O/c1-11-14-4-2-3-5-15(14)20-16(11)17(22)21-19-10-12-6-8-13(18)9-7-12/h2-10,20H,1H3,(H,21,22) |
| InChIKey | QDRACQFMGALPNW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|