C23H16Cl2N4O — CID 14983889
N-[(E)-(4-chlorophenyl)methylideneamino]-3-[(4-chlorophenyl)methylideneamino]-1H-indole-2-carboxamide (PubChem CID 14983889) has the molecular formula C23H16Cl2N4O and a molecular weight of 435.31 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-3-[(4-chlorophenyl)methylideneamino]-1H-indole-2-carboxamide.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-3-[(4-chlorophenyl)methylideneamino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 14983889 |
| Molecular Formula | C23H16Cl2N4O |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-3-[(4-chlorophenyl)methylideneamino]-1H-indole-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1)c1[nH]c2ccccc2c1/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H16Cl2N4O/c24-17-9-5-15(6-10-17)13-26-21-19-3-1-2-4-20(19)28-22(21)23(30)29-27-14-16-7-11-18(25)12-8-16/h1-14,28H,(H,29,30)/b26-13+,27-14+ |
| InChIKey | VYXLUPBGINKXOW-BMNRKXRESA-N |
| XLogP | 5.99 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|