C22H15ClFN3O — CID 70130221
N-[(4-chlorophenyl)methylideneamino]-3-(4-fluorophenyl)-1H-indole-2-carboxamide (PubChem CID 70130221) has the molecular formula C22H15ClFN3O and a molecular weight of 391.83 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methylideneamino]-3-(4-fluorophenyl)-1H-indole-2-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methylideneamino]-3-(4-fluorophenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70130221 |
| Molecular Formula | C22H15ClFN3O |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-[(4-chlorophenyl)methylideneamino]-3-(4-fluorophenyl)-1H-indole-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1)c1[nH]c2ccccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H15ClFN3O/c23-16-9-5-14(6-10-16)13-25-27-22(28)21-20(15-7-11-17(24)12-8-15)18-3-1-2-4-19(18)26-21/h1-13,26H,(H,27,28) |
| InChIKey | BVSOHZIQEZPXQG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|