C26H24N4O — CID 10272869
3-phenyl-N-[(E)-(4-pyrrolidin-1-ylphenyl)methylideneamino]-1H-indole-2-carboxamide (PubChem CID 10272869) has the molecular formula C26H24N4O and a molecular weight of 408.51 g/mol. Its IUPAC name is 3-phenyl-N-[(E)-(4-pyrrolidin-1-ylphenyl)methylideneamino]-1H-indole-2-carboxamide.
| Compound Name | 3-phenyl-N-[(E)-(4-pyrrolidin-1-ylphenyl)methylideneamino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 10272869 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-phenyl-N-[(E)-(4-pyrrolidin-1-ylphenyl)methylideneamino]-1H-indole-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(N2CCCC2)cc1)c1[nH]c2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C26H24N4O/c31-26(29-27-18-19-12-14-21(15-13-19)30-16-6-7-17-30)25-24(20-8-2-1-3-9-20)22-10-4-5-11-23(22)28-25/h1-5,8-15,18,28H,6-7,16-17H2,(H,29,31)/b27-18+ |
| InChIKey | NBXTXHJWSMTTKO-OVVQPSECSA-N |
| XLogP | 5.20 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|