C19H15N5O — CID 135418261
N-[(E)-1H-imidazol-2-ylmethylideneamino]-3-phenyl-1H-indole-2-carboxamide (PubChem CID 135418261) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is N-[(E)-1H-imidazol-2-ylmethylideneamino]-3-phenyl-1H-indole-2-carboxamide.
| Compound Name | N-[(E)-1H-imidazol-2-ylmethylideneamino]-3-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135418261 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[(E)-1H-imidazol-2-ylmethylideneamino]-3-phenyl-1H-indole-2-carboxamide |
| SMILES | O=C(N/N=C/c1ncc[nH]1)c1[nH]c2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C19H15N5O/c25-19(24-22-12-16-20-10-11-21-16)18-17(13-6-2-1-3-7-13)14-8-4-5-9-15(14)23-18/h1-12,23H,(H,20,21)(H,24,25)/b22-12+ |
| InChIKey | WWKJIUOZDAKNRR-WSDLNYQXSA-N |
| XLogP | 3.32 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|