C11H10N4O — CID 137321091
N-[(Z)-1H-imidazol-2-ylmethylideneamino]benzamide (PubChem CID 137321091) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is N-[(Z)-1H-imidazol-2-ylmethylideneamino]benzamide.
| Compound Name | N-[(Z)-1H-imidazol-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 137321091 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-[(Z)-1H-imidazol-2-ylmethylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ncc[nH]1)c1ccccc1 |
| InChI | InChI=1S/C11H10N4O/c16-11(9-4-2-1-3-5-9)15-14-8-10-12-6-7-13-10/h1-8H,(H,12,13)(H,15,16)/b14-8- |
| InChIKey | ZTEVJFGYNWXWNE-ZSOIEALJSA-N |
| XLogP | 1.17 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|