C14H11N5O — CID 136919029
N-[(Z)-1H-benzimidazol-2-ylmethylideneamino]pyridine-3-carboxamide (PubChem CID 136919029) has the molecular formula C14H11N5O and a molecular weight of 265.28 g/mol. Its IUPAC name is N-[(Z)-1H-benzimidazol-2-ylmethylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-1H-benzimidazol-2-ylmethylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 136919029 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-[(Z)-1H-benzimidazol-2-ylmethylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C\c1nc2ccccc2[nH]1)c1cccnc1 |
| InChI | InChI=1S/C14H11N5O/c20-14(10-4-3-7-15-8-10)19-16-9-13-17-11-5-1-2-6-12(11)18-13/h1-9H,(H,17,18)(H,19,20)/b16-9- |
| InChIKey | MPNBIVZGDOFBBW-SXGWCWSVSA-N |
| XLogP | 1.72 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|