C9H9N3O — CID 4591479
N-(prop-2-enylideneamino)pyridine-3-carboxamide (PubChem CID 4591479) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is N-(prop-2-enylideneamino)pyridine-3-carboxamide.
| Compound Name | N-(prop-2-enylideneamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4591479 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | N-(prop-2-enylideneamino)pyridine-3-carboxamide |
| SMILES | C=CC=NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C9H9N3O/c1-2-5-11-12-9(13)8-4-3-6-10-7-8/h2-7H,1H2,(H,12,13) |
| InChIKey | JIFNCTDQAJQGHF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|