C14H10N4O — CID 6895632
N-[(E)-(4-cyanophenyl)methylideneamino]pyridine-3-carboxamide (PubChem CID 6895632) has the molecular formula C14H10N4O and a molecular weight of 250.26 g/mol. Its IUPAC name is N-[(E)-(4-cyanophenyl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-(4-cyanophenyl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6895632 |
| Molecular Formula | C14H10N4O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | N-[(E)-(4-cyanophenyl)methylideneamino]pyridine-3-carboxamide |
| SMILES | N#Cc1ccc(/C=N/NC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C14H10N4O/c15-8-11-3-5-12(6-4-11)9-17-18-14(19)13-2-1-7-16-10-13/h1-7,9-10H,(H,18,19)/b17-9+ |
| InChIKey | YPFUELDHLRTWOK-RQZCQDPDSA-N |
| XLogP | 1.72 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|