C16H15N3O4 — CID 44714938
2-[4-[(E)-(pyridine-3-carbonylhydrazinylidene)methyl]phenoxy]propanoic acid (PubChem CID 44714938) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-[4-[(E)-(pyridine-3-carbonylhydrazinylidene)methyl]phenoxy]propanoic acid.
| Compound Name | 2-[4-[(E)-(pyridine-3-carbonylhydrazinylidene)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 44714938 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-[4-[(E)-(pyridine-3-carbonylhydrazinylidene)methyl]phenoxy]propanoic acid |
| SMILES | CC(Oc1ccc(/C=N/NC(=O)c2cccnc2)cc1)C(=O)O |
| InChI | InChI=1S/C16H15N3O4/c1-11(16(21)22)23-14-6-4-12(5-7-14)9-18-19-15(20)13-3-2-8-17-10-13/h2-11H,1H3,(H,19,20)(H,21,22)/b18-9+ |
| InChIKey | BBKNRFVRQIWYAO-GIJQJNRQSA-N |
| XLogP | 1.70 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|