C20H14ClN3O3 — CID 4522806
[4-[(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 3-chlorobenzoate (PubChem CID 4522806) has the molecular formula C20H14ClN3O3 and a molecular weight of 379.80 g/mol. Its IUPAC name is [4-[(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 3-chlorobenzoate.
| Compound Name | [4-[(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 4522806 |
| Molecular Formula | C20H14ClN3O3 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | [4-[(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 3-chlorobenzoate |
| SMILES | O=C(NN=Cc1ccc(OC(=O)c2cccc(Cl)c2)cc1)c1cccnc1 |
| InChI | InChI=1S/C20H14ClN3O3/c21-17-5-1-3-15(11-17)20(26)27-18-8-6-14(7-9-18)12-23-24-19(25)16-4-2-10-22-13-16/h1-13H,(H,24,25) |
| InChIKey | JNDZZAFGIPAQOP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|