C22H17ClN2O4 — CID 3702836
[4-[[(3-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chlorobenzoate (PubChem CID 3702836) has the molecular formula C22H17ClN2O4 and a molecular weight of 408.84 g/mol. Its IUPAC name is [4-[[(3-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chlorobenzoate.
| Compound Name | [4-[[(3-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 3702836 |
| Molecular Formula | C22H17ClN2O4 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [4-[[(3-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chlorobenzoate |
| SMILES | COc1cccc(C(=O)NN=Cc2ccc(OC(=O)c3cccc(Cl)c3)cc2)c1 |
| InChI | InChI=1S/C22H17ClN2O4/c1-28-20-7-3-4-16(13-20)21(26)25-24-14-15-8-10-19(11-9-15)29-22(27)17-5-2-6-18(23)12-17/h2-14H,1H3,(H,25,26) |
| InChIKey | GIWZWJMGYANLHV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|