C23H19ClN2O5 — CID 3793766
[4-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chlorobenzoate (PubChem CID 3793766) has the molecular formula C23H19ClN2O5 and a molecular weight of 438.87 g/mol. Its IUPAC name is [4-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chlorobenzoate.
| Compound Name | [4-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 3793766 |
| Molecular Formula | C23H19ClN2O5 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | [4-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chlorobenzoate |
| SMILES | COc1ccc(C(=O)NN=Cc2ccc(OC(=O)c3cccc(Cl)c3)cc2)cc1OC |
| InChI | InChI=1S/C23H19ClN2O5/c1-29-20-11-8-16(13-21(20)30-2)22(27)26-25-14-15-6-9-19(10-7-15)31-23(28)17-4-3-5-18(24)12-17/h3-14H,1-2H3,(H,26,27) |
| InChIKey | NZFWAJUMCJMZGQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|