C21H15N3O — CID 681341
N-[(4-cyanophenyl)methylideneamino]-4-phenylbenzamide (PubChem CID 681341) has the molecular formula C21H15N3O and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methylideneamino]-4-phenylbenzamide.
| Compound Name | N-[(4-cyanophenyl)methylideneamino]-4-phenylbenzamide |
|---|---|
| PubChem CID | 681341 |
| Molecular Formula | C21H15N3O |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[(4-cyanophenyl)methylideneamino]-4-phenylbenzamide |
| SMILES | N#Cc1ccc(C=NNC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C21H15N3O/c22-14-16-6-8-17(9-7-16)15-23-24-21(25)20-12-10-19(11-13-20)18-4-2-1-3-5-18/h1-13,15H,(H,24,25) |
| InChIKey | JRRJJKCKHQCOBQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|