C10H9N5O3 — CID 57393166
N-[(E)-(4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-yl)methylideneamino]pyridine-3-carboxamide (PubChem CID 57393166) has the molecular formula C10H9N5O3 and a molecular weight of 247.21 g/mol. Its IUPAC name is N-[(E)-(4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-yl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-(4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-yl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 57393166 |
| Molecular Formula | C10H9N5O3 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-[(E)-(4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-yl)methylideneamino]pyridine-3-carboxamide |
| SMILES | Cc1c(/C=N/NC(=O)c2cccnc2)no[n+]1[O-] |
| InChI | InChI=1S/C10H9N5O3/c1-7-9(14-18-15(7)17)6-12-13-10(16)8-3-2-4-11-5-8/h2-6H,1H3,(H,13,16)/b12-6+ |
| InChIKey | GBTXJSQFLIJBFW-WUXMJOGZSA-N |
| XLogP | -0.22 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|