C17H13N5O4 — CID 135733865
N-[(E)-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]pyridine-3-carboxamide (PubChem CID 135733865) has the molecular formula C17H13N5O4 and a molecular weight of 351.32 g/mol. Its IUPAC name is N-[(E)-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135733865 |
| Molecular Formula | C17H13N5O4 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[(E)-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C/c1c(O)n(-c2ccccc2)c(=O)[nH]c1=O)c1cccnc1 |
| InChI | InChI=1S/C17H13N5O4/c23-14(11-5-4-8-18-9-11)21-19-10-13-15(24)20-17(26)22(16(13)25)12-6-2-1-3-7-12/h1-10,25H,(H,21,23)(H,20,24,26)/b19-10+ |
| InChIKey | AMQGXFVKJXDISE-VXLYETTFSA-N |
| XLogP | 0.39 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|