C19H17N5O4 — CID 135684719
N-[(E)-[1-(2-ethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]pyridine-3-carboxamide (PubChem CID 135684719) has the molecular formula C19H17N5O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is N-[(E)-[1-(2-ethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-[1-(2-ethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135684719 |
| Molecular Formula | C19H17N5O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[(E)-[1-(2-ethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]pyridine-3-carboxamide |
| SMILES | CCc1ccccc1-n1c(O)c(/C=N/NC(=O)c2cccnc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H17N5O4/c1-2-12-6-3-4-8-15(12)24-18(27)14(17(26)22-19(24)28)11-21-23-16(25)13-7-5-9-20-10-13/h3-11,27H,2H2,1H3,(H,23,25)(H,22,26,28)/b21-11+ |
| InChIKey | ASDPESJNIAIRNV-SRZZPIQSSA-N |
| XLogP | 0.95 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|