C20H17ClN4O5 — CID 2024283
2-chloro-N-[[1-(2-ethoxyphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzamide (PubChem CID 2024283) has the molecular formula C20H17ClN4O5 and a molecular weight of 428.83 g/mol. Its IUPAC name is 2-chloro-N-[[1-(2-ethoxyphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzamide.
| Compound Name | 2-chloro-N-[[1-(2-ethoxyphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 2024283 |
| Molecular Formula | C20H17ClN4O5 |
| Molecular Weight | 428.83 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-chloro-N-[[1-(2-ethoxyphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzamide |
| SMILES | CCOc1ccccc1-n1c(O)c(C=NNC(=O)c2ccccc2Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H17ClN4O5/c1-2-30-16-10-6-5-9-15(16)25-19(28)13(17(26)23-20(25)29)11-22-24-18(27)12-7-3-4-8-14(12)21/h3-11,28H,2H2,1H3,(H,24,27)(H,23,26,29) |
| InChIKey | IWRNYRGRAXBYEK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.83 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|