C12H10ClN5O4 — CID 135717075
[(E)-[1-(2-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]urea (PubChem CID 135717075) has the molecular formula C12H10ClN5O4 and a molecular weight of 323.70 g/mol. Its IUPAC name is [(E)-[1-(2-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]urea.
| Compound Name | [(E)-[1-(2-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 135717075 |
| Molecular Formula | C12H10ClN5O4 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | [(E)-[1-(2-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]urea |
| SMILES | NC(=O)N/N=C/c1c(O)n(-c2ccccc2Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H10ClN5O4/c13-7-3-1-2-4-8(7)18-10(20)6(5-15-17-11(14)21)9(19)16-12(18)22/h1-5,20H,(H3,14,17,21)(H,16,19,22)/b15-5+ |
| InChIKey | RPEOMKGEIHGQIV-PJQLUOCWSA-N |
| XLogP | -0.11 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|