C16H17ClN4O3S — CID 135493390
N-[(E)-[1-(2-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]pentanamide (PubChem CID 135493390) has the molecular formula C16H17ClN4O3S and a molecular weight of 380.86 g/mol. Its IUPAC name is N-[(E)-[1-(2-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]pentanamide.
| Compound Name | N-[(E)-[1-(2-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]pentanamide |
|---|---|
| PubChem CID | 135493390 |
| Molecular Formula | C16H17ClN4O3S |
| Molecular Weight | 380.86 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-[(E)-[1-(2-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]pentanamide |
| SMILES | CCCCC(=O)N/N=C/c1c(O)n(-c2ccccc2Cl)c(=S)[nH]c1=O |
| InChI | InChI=1S/C16H17ClN4O3S/c1-2-3-8-13(22)20-18-9-10-14(23)19-16(25)21(15(10)24)12-7-5-4-6-11(12)17/h4-7,9,24H,2-3,8H2,1H3,(H,20,22)(H,19,23,25)/b18-9+ |
| InChIKey | GEOWDFDRLCKRJB-GIJQJNRQSA-N |
| XLogP | 2.89 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.86 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|