C21H19ClN4O4 — CID 137070211
2-chloro-N-[[6-hydroxy-2,4-dioxo-1-(2,4,6-trimethylphenyl)pyrimidin-5-yl]methylideneamino]benzamide (PubChem CID 137070211) has the molecular formula C21H19ClN4O4 and a molecular weight of 426.86 g/mol. Its IUPAC name is 2-chloro-N-[[6-hydroxy-2,4-dioxo-1-(2,4,6-trimethylphenyl)pyrimidin-5-yl]methylideneamino]benzamide.
| Compound Name | 2-chloro-N-[[6-hydroxy-2,4-dioxo-1-(2,4,6-trimethylphenyl)pyrimidin-5-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 137070211 |
| Molecular Formula | C21H19ClN4O4 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-chloro-N-[[6-hydroxy-2,4-dioxo-1-(2,4,6-trimethylphenyl)pyrimidin-5-yl]methylideneamino]benzamide |
| SMILES | Cc1cc(C)c(-n2c(O)c(C=NNC(=O)c3ccccc3Cl)c(=O)[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C21H19ClN4O4/c1-11-8-12(2)17(13(3)9-11)26-20(29)15(18(27)24-21(26)30)10-23-25-19(28)14-6-4-5-7-16(14)22/h4-10,29H,1-3H3,(H,25,28)(H,24,27,30) |
| InChIKey | UJQNXVCDSFBYMZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|