C18H12BrClN4O4 — CID 3372682
N-[[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-chlorobenzamide (PubChem CID 3372682) has the molecular formula C18H12BrClN4O4 and a molecular weight of 463.68 g/mol. Its IUPAC name is N-[[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-chlorobenzamide.
| Compound Name | N-[[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-chlorobenzamide |
|---|---|
| PubChem CID | 3372682 |
| Molecular Formula | C18H12BrClN4O4 |
| Molecular Weight | 463.68 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | N-[[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-chlorobenzamide |
| SMILES | O=C(NN=Cc1c(O)n(-c2ccc(Br)cc2)c(=O)[nH]c1=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H12BrClN4O4/c19-10-5-7-11(8-6-10)24-17(27)13(15(25)22-18(24)28)9-21-23-16(26)12-3-1-2-4-14(12)20/h1-9,27H,(H,23,26)(H,22,25,28) |
| InChIKey | IOYGSUGCYUYVKX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.68 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|