C18H21BrN4O4 — CID 135481364
N-[(E)-[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]heptanamide (PubChem CID 135481364) has the molecular formula C18H21BrN4O4 and a molecular weight of 437.29 g/mol. Its IUPAC name is N-[(E)-[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]heptanamide.
| Compound Name | N-[(E)-[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]heptanamide |
|---|---|
| PubChem CID | 135481364 |
| Molecular Formula | C18H21BrN4O4 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | N-[(E)-[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]heptanamide |
| SMILES | CCCCCCC(=O)N/N=C/c1c(O)n(-c2ccc(Br)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H21BrN4O4/c1-2-3-4-5-6-15(24)22-20-11-14-16(25)21-18(27)23(17(14)26)13-9-7-12(19)8-10-13/h7-11,26H,2-6H2,1H3,(H,22,24)(H,21,25,27)/b20-11+ |
| InChIKey | YYNFVNIPPLSCFU-RGVLZGJSSA-N |
| XLogP | 2.41 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|