C18H30N4O4 — CID 135717455
N-[(E)-(1-hexyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)methylideneamino]heptanamide (PubChem CID 135717455) has the molecular formula C18H30N4O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[(E)-(1-hexyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)methylideneamino]heptanamide.
| Compound Name | N-[(E)-(1-hexyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)methylideneamino]heptanamide |
|---|---|
| PubChem CID | 135717455 |
| Molecular Formula | C18H30N4O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[(E)-(1-hexyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)methylideneamino]heptanamide |
| SMILES | CCCCCCC(=O)N/N=C/c1c(O)n(CCCCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H30N4O4/c1-3-5-7-9-11-15(23)21-19-13-14-16(24)20-18(26)22(17(14)25)12-10-8-6-4-2/h13,25H,3-12H2,1-2H3,(H,21,23)(H,20,24,26)/b19-13+ |
| InChIKey | YMXAFUHMIPNCLK-CPNJWEJPSA-N |
| XLogP | 2.24 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|