C18H14BrN5O4 — CID 135752219
1-[(E)-[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylurea (PubChem CID 135752219) has the molecular formula C18H14BrN5O4 and a molecular weight of 444.25 g/mol. Its IUPAC name is 1-[(E)-[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylurea.
| Compound Name | 1-[(E)-[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 135752219 |
| Molecular Formula | C18H14BrN5O4 |
| Molecular Weight | 444.25 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 1-[(E)-[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylurea |
| SMILES | O=C(N/N=C/c1c(O)n(-c2ccc(Br)cc2)c(=O)[nH]c1=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H14BrN5O4/c19-11-6-8-13(9-7-11)24-16(26)14(15(25)22-18(24)28)10-20-23-17(27)21-12-4-2-1-3-5-12/h1-10,26H,(H2,21,23,27)(H,22,25,28)/b20-10+ |
| InChIKey | NLFLMKYBOPPLOC-KEBDBYFISA-N |
| XLogP | 2.15 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|