C22H24N4O4 — CID 3119719
N-[(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]adamantane-1-carboxamide (PubChem CID 3119719) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]adamantane-1-carboxamide.
| Compound Name | N-[(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 3119719 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-[(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]adamantane-1-carboxamide |
| SMILES | O=C(NN=Cc1c(O)n(-c2ccccc2)c(=O)[nH]c1=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H24N4O4/c27-18-17(19(28)26(21(30)24-18)16-4-2-1-3-5-16)12-23-25-20(29)22-9-13-6-14(10-22)8-15(7-13)11-22/h1-5,12-15,28H,6-11H2,(H,25,29)(H,24,27,30) |
| InChIKey | HNFXKKBHOIFNGW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|