C27H35N5O — CID 6042470
N-[(Z)-(3-methyl-1-phenyl-5-piperidin-1-ylpyrazol-4-yl)methylideneamino]adamantane-1-carboxamide (PubChem CID 6042470) has the molecular formula C27H35N5O and a molecular weight of 445.61 g/mol. Its IUPAC name is N-[(Z)-(3-methyl-1-phenyl-5-piperidin-1-ylpyrazol-4-yl)methylideneamino]adamantane-1-carboxamide.
| Compound Name | N-[(Z)-(3-methyl-1-phenyl-5-piperidin-1-ylpyrazol-4-yl)methylideneamino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 6042470 |
| Molecular Formula | C27H35N5O |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | N-[(Z)-(3-methyl-1-phenyl-5-piperidin-1-ylpyrazol-4-yl)methylideneamino]adamantane-1-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(N2CCCCC2)c1/C=N\NC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H35N5O/c1-19-24(18-28-29-26(33)27-15-20-12-21(16-27)14-22(13-20)17-27)25(31-10-6-3-7-11-31)32(30-19)23-8-4-2-5-9-23/h2,4-5,8-9,18,20-22H,3,6-7,10-17H2,1H3,(H,29,33)/b28-18- |
| InChIKey | NQDCTLNHOSXYLJ-VEILYXNESA-N |
| XLogP | 4.84 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|