C22H27N7 — CID 6010547
4,6-dimethyl-N-[(Z)-(3-methyl-1-phenyl-5-piperidin-1-ylpyrazol-4-yl)methylideneamino]pyrimidin-2-amine (PubChem CID 6010547) has the molecular formula C22H27N7 and a molecular weight of 389.51 g/mol. Its IUPAC name is 4,6-dimethyl-N-[(Z)-(3-methyl-1-phenyl-5-piperidin-1-ylpyrazol-4-yl)methylideneamino]pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-[(Z)-(3-methyl-1-phenyl-5-piperidin-1-ylpyrazol-4-yl)methylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 6010547 |
| Molecular Formula | C22H27N7 |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 4,6-dimethyl-N-[(Z)-(3-methyl-1-phenyl-5-piperidin-1-ylpyrazol-4-yl)methylideneamino]pyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(N/N=C\c2c(C)nn(-c3ccccc3)c2N2CCCCC2)n1 |
| InChI | InChI=1S/C22H27N7/c1-16-14-17(2)25-22(24-16)26-23-15-20-18(3)27-29(19-10-6-4-7-11-19)21(20)28-12-8-5-9-13-28/h4,6-7,10-11,14-15H,5,8-9,12-13H2,1-3H3,(H,24,25,26)/b23-15- |
| InChIKey | KBOFTUSIOZGLRW-HAHDFKILSA-N |
| XLogP | 4.02 |
| TPSA | 71.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|