C18H14IN5O3S — CID 135679603
1-[(E)-[6-hydroxy-1-(4-iodophenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylthiourea (PubChem CID 135679603) has the molecular formula C18H14IN5O3S and a molecular weight of 507.31 g/mol. Its IUPAC name is 1-[(E)-[6-hydroxy-1-(4-iodophenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-[6-hydroxy-1-(4-iodophenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 135679603 |
| Molecular Formula | C18H14IN5O3S |
| Molecular Weight | 507.31 g/mol |
| Exact Mass | 506.99 |
| IUPAC Name | 1-[(E)-[6-hydroxy-1-(4-iodophenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylthiourea |
| SMILES | O=c1[nH]c(=O)n(-c2ccc(I)cc2)c(O)c1/C=N/NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C18H14IN5O3S/c19-11-6-8-13(9-7-11)24-16(26)14(15(25)22-18(24)27)10-20-23-17(28)21-12-4-2-1-3-5-12/h1-10,26H,(H2,21,23,28)(H,22,25,27)/b20-10+ |
| InChIKey | MOBZUTPPRLBIAZ-KEBDBYFISA-N |
| XLogP | 2.16 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|