C18H21N5O2S2 — CID 4551023
1-[(1-cyclohexyl-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-3-phenylthiourea (PubChem CID 4551023) has the molecular formula C18H21N5O2S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 1-[(1-cyclohexyl-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(1-cyclohexyl-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 4551023 |
| Molecular Formula | C18H21N5O2S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 1-[(1-cyclohexyl-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-3-phenylthiourea |
| SMILES | O=c1[nH]c(=S)n(C2CCCCC2)c(O)c1C=NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C18H21N5O2S2/c24-15-14(11-19-22-17(26)20-12-7-3-1-4-8-12)16(25)23(18(27)21-15)13-9-5-2-6-10-13/h1,3-4,7-8,11,13,25H,2,5-6,9-10H2,(H2,20,22,26)(H,21,24,27) |
| InChIKey | XWLQTHVNFAUSJV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|