C20H23N5O2S2 — CID 3768498
1-[[1-[2-(cyclohexen-1-yl)ethyl]-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-3-phenylthiourea (PubChem CID 3768498) has the molecular formula C20H23N5O2S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 1-[[1-[2-(cyclohexen-1-yl)ethyl]-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[[1-[2-(cyclohexen-1-yl)ethyl]-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 3768498 |
| Molecular Formula | C20H23N5O2S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 1-[[1-[2-(cyclohexen-1-yl)ethyl]-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-3-phenylthiourea |
| SMILES | O=c1[nH]c(=S)n(CCC2=CCCCC2)c(O)c1C=NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C20H23N5O2S2/c26-17-16(13-21-24-19(28)22-15-9-5-2-6-10-15)18(27)25(20(29)23-17)12-11-14-7-3-1-4-8-14/h2,5-7,9-10,13,27H,1,3-4,8,11-12H2,(H2,22,24,28)(H,23,26,29) |
| InChIKey | BEXCXPFZLSTBEV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|