C19H17N5O3S2 — CID 135821883
1-[(E)-[6-hydroxy-1-(4-methoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-3-phenylthiourea (PubChem CID 135821883) has the molecular formula C19H17N5O3S2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-[(E)-[6-hydroxy-1-(4-methoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-[6-hydroxy-1-(4-methoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 135821883 |
| Molecular Formula | C19H17N5O3S2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 1-[(E)-[6-hydroxy-1-(4-methoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-3-phenylthiourea |
| SMILES | COc1ccc(-n2c(O)c(/C=N/NC(=S)Nc3ccccc3)c(=O)[nH]c2=S)cc1 |
| InChI | InChI=1S/C19H17N5O3S2/c1-27-14-9-7-13(8-10-14)24-17(26)15(16(25)22-19(24)29)11-20-23-18(28)21-12-5-3-2-4-6-12/h2-11,26H,1H3,(H2,21,23,28)(H,22,25,29)/b20-11+ |
| InChIKey | LLHMTFWIZUGKIZ-RGVLZGJSSA-N |
| XLogP | 2.93 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|